C12H16FN5 — CID 114829652
1-(4-fluorophenyl)-N-[1-(2H-tetrazol-5-yl)ethyl]propan-2-amine (PubChem CID 114829652) has the molecular formula C12H16FN5 and a molecular weight of 249.29 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[1-(2H-tetrazol-5-yl)ethyl]propan-2-amine.
| Compound Name | 1-(4-fluorophenyl)-N-[1-(2H-tetrazol-5-yl)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 114829652 |
| Molecular Formula | C12H16FN5 |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[1-(2H-tetrazol-5-yl)ethyl]propan-2-amine |
| SMILES | CC(Cc1ccc(F)cc1)NC(C)c1nn[nH]n1 |
| InChI | InChI=1S/C12H16FN5/c1-8(7-10-3-5-11(13)6-4-10)14-9(2)12-15-17-18-16-12/h3-6,8-9,14H,7H2,1-2H3,(H,15,16,17,18) |
| InChIKey | WBMCCUWAABQYEL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |