C7H10F3N5O2 — CID 103209251
N-[1-(2H-tetrazol-5-yl)ethyl]-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 103209251) has the molecular formula C7H10F3N5O2 and a molecular weight of 253.18 g/mol. Its IUPAC name is N-[1-(2H-tetrazol-5-yl)ethyl]-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-[1-(2H-tetrazol-5-yl)ethyl]-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 103209251 |
| Molecular Formula | C7H10F3N5O2 |
| Molecular Weight | 253.18 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | N-[1-(2H-tetrazol-5-yl)ethyl]-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | CC(NC(=O)COCC(F)(F)F)c1nn[nH]n1 |
| InChI | InChI=1S/C7H10F3N5O2/c1-4(6-12-14-15-13-6)11-5(16)2-17-3-7(8,9)10/h4H,2-3H2,1H3,(H,11,16)(H,12,13,14,15) |
| InChIKey | GLWGRQTUISHVMN-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.18 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |