C10H17N5O3 — CID 116537012
3,3-dimethyl-2-[1-(2H-tetrazol-5-yl)ethylcarbamoyl]butanoic acid (PubChem CID 116537012) has the molecular formula C10H17N5O3 and a molecular weight of 255.28 g/mol. Its IUPAC name is 3,3-dimethyl-2-[1-(2H-tetrazol-5-yl)ethylcarbamoyl]butanoic acid.
| Compound Name | 3,3-dimethyl-2-[1-(2H-tetrazol-5-yl)ethylcarbamoyl]butanoic acid |
|---|---|
| PubChem CID | 116537012 |
| Molecular Formula | C10H17N5O3 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 3,3-dimethyl-2-[1-(2H-tetrazol-5-yl)ethylcarbamoyl]butanoic acid |
| SMILES | CC(NC(=O)C(C(=O)O)C(C)(C)C)c1nn[nH]n1 |
| InChI | InChI=1S/C10H17N5O3/c1-5(7-12-14-15-13-7)11-8(16)6(9(17)18)10(2,3)4/h5-6H,1-4H3,(H,11,16)(H,17,18)(H,12,13,14,15) |
| InChIKey | AHSFINJWWRLHKH-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|