C5H10N6S — CID 116507980
1-methyl-3-[1-(2H-tetrazol-5-yl)ethyl]thiourea (PubChem CID 116507980) has the molecular formula C5H10N6S and a molecular weight of 186.24 g/mol. Its IUPAC name is 1-methyl-3-[1-(2H-tetrazol-5-yl)ethyl]thiourea.
| Compound Name | 1-methyl-3-[1-(2H-tetrazol-5-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 116507980 |
| Molecular Formula | C5H10N6S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 1-methyl-3-[1-(2H-tetrazol-5-yl)ethyl]thiourea |
| SMILES | CNC(=S)NC(C)c1nn[nH]n1 |
| InChI | InChI=1S/C5H10N6S/c1-3(7-5(12)6-2)4-8-10-11-9-4/h3H,1-2H3,(H2,6,7,12)(H,8,9,10,11) |
| InChIKey | IQOKCFRWIZASAA-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|