C15H29N5O — CID 65426546
N-[1-(2H-tetrazol-5-yl)ethyl]dodecanamide (PubChem CID 65426546) has the molecular formula C15H29N5O and a molecular weight of 295.43 g/mol. Its IUPAC name is N-[1-(2H-tetrazol-5-yl)ethyl]dodecanamide.
| Compound Name | N-[1-(2H-tetrazol-5-yl)ethyl]dodecanamide |
|---|---|
| PubChem CID | 65426546 |
| Molecular Formula | C15H29N5O |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.24 |
| IUPAC Name | N-[1-(2H-tetrazol-5-yl)ethyl]dodecanamide |
| SMILES | CCCCCCCCCCCC(=O)NC(C)c1nn[nH]n1 |
| InChI | InChI=1S/C15H29N5O/c1-3-4-5-6-7-8-9-10-11-12-14(21)16-13(2)15-17-19-20-18-15/h13H,3-12H2,1-2H3,(H,16,21)(H,17,18,19,20) |
| InChIKey | QVOJURUKLVQGKZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|