C10H21ClN6O — CID 119813138
4-(methylamino)-N-[1-(2H-tetrazol-5-yl)butyl]butanamide;hydrochloride (PubChem CID 119813138) has the molecular formula C10H21ClN6O and a molecular weight of 276.77 g/mol. Its IUPAC name is 4-(methylamino)-N-[1-(2H-tetrazol-5-yl)butyl]butanamide;hydrochloride.
| Compound Name | 4-(methylamino)-N-[1-(2H-tetrazol-5-yl)butyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119813138 |
| Molecular Formula | C10H21ClN6O |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 4-(methylamino)-N-[1-(2H-tetrazol-5-yl)butyl]butanamide;hydrochloride |
| SMILES | CCCC(NC(=O)CCCNC)c1nn[nH]n1.Cl |
| InChI | InChI=1S/C10H20N6O.ClH/c1-3-5-8(10-13-15-16-14-10)12-9(17)6-4-7-11-2;/h8,11H,3-7H2,1-2H3,(H,12,17)(H,13,14,15,16);1H |
| InChIKey | UBGMJUSRKTZXHY-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|