C10H20N6O2 — CID 119813161
2-(2-methoxyethylamino)-N-[1-(2H-tetrazol-5-yl)butyl]acetamide (PubChem CID 119813161) has the molecular formula C10H20N6O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-[1-(2H-tetrazol-5-yl)butyl]acetamide.
| Compound Name | 2-(2-methoxyethylamino)-N-[1-(2H-tetrazol-5-yl)butyl]acetamide |
|---|---|
| PubChem CID | 119813161 |
| Molecular Formula | C10H20N6O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-[1-(2H-tetrazol-5-yl)butyl]acetamide |
| SMILES | CCCC(NC(=O)CNCCOC)c1nn[nH]n1 |
| InChI | InChI=1S/C10H20N6O2/c1-3-4-8(10-13-15-16-14-10)12-9(17)7-11-5-6-18-2/h8,11H,3-7H2,1-2H3,(H,12,17)(H,13,14,15,16) |
| InChIKey | HFEFPXRAKPYZFK-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|