C7H16N8 — CID 104884896
1-amino-2-propyl-3-[1-(2H-tetrazol-5-yl)ethyl]guanidine (PubChem CID 104884896) has the molecular formula C7H16N8 and a molecular weight of 212.26 g/mol. Its IUPAC name is 1-amino-2-propyl-3-[1-(2H-tetrazol-5-yl)ethyl]guanidine.
| Compound Name | 1-amino-2-propyl-3-[1-(2H-tetrazol-5-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 104884896 |
| Molecular Formula | C7H16N8 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 1-amino-2-propyl-3-[1-(2H-tetrazol-5-yl)ethyl]guanidine |
| SMILES | CCC/N=C(\NN)NC(C)c1nn[nH]n1 |
| InChI | InChI=1S/C7H16N8/c1-3-4-9-7(11-8)10-5(2)6-12-14-15-13-6/h5H,3-4,8H2,1-2H3,(H2,9,10,11)(H,12,13,14,15) |
| InChIKey | HYYHUTJJGKQQCA-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 116.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|