C7H12N6O — CID 62700432
1-cyclopropyl-3-[1-(2H-tetrazol-5-yl)ethyl]urea (PubChem CID 62700432) has the molecular formula C7H12N6O and a molecular weight of 196.21 g/mol. Its IUPAC name is 1-cyclopropyl-3-[1-(2H-tetrazol-5-yl)ethyl]urea.
| Compound Name | 1-cyclopropyl-3-[1-(2H-tetrazol-5-yl)ethyl]urea |
|---|---|
| PubChem CID | 62700432 |
| Molecular Formula | C7H12N6O |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 1-cyclopropyl-3-[1-(2H-tetrazol-5-yl)ethyl]urea |
| SMILES | CC(NC(=O)NC1CC1)c1nn[nH]n1 |
| InChI | InChI=1S/C7H12N6O/c1-4(6-10-12-13-11-6)8-7(14)9-5-2-3-5/h4-5H,2-3H2,1H3,(H2,8,9,14)(H,10,11,12,13) |
| InChIKey | JWFGHPCQIAMCNQ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |