About 1-cyclopropyl-3-[1-(1,2,4-oxadiazol-3-yl)ethyl]urea
1-cyclopropyl-3-[1-(1,2,4-oxadiazol-3-yl)ethyl]urea (PubChem CID 130941339) has the molecular formula C8H12N4O2
and a molecular weight of 196.21 g/mol. Its IUPAC name is 1-cyclopropyl-3-[1-(1,2,4-oxadiazol-3-yl)ethyl]urea.
Molecular Properties
| Compound Name | 1-cyclopropyl-3-[1-(1,2,4-oxadiazol-3-yl)ethyl]urea |
| PubChem CID | 130941339 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-cyclopropyl-3-[1-(1,2,4-oxadiazol-3-yl)ethyl]urea |
| SMILES | CC(NC(=O)NC1CC1)c1ncon1 |
| InChI | InChI=1S/C8H12N4O2/c1-5(7-9-4-14-12-7)10-8(13)11-6-2-3-6/h4-6H,2-3H2,1H3,(H2,10,11,13) |
| InChIKey | RJANBJBXFWPVEB-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cyclopropyl-3-[1-(1,2,4-oxadiazol-3-yl)ethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-3-[1-(1,2,4-oxadiazol-3-yl)ethyl]urea?
The IUPAC name of 1-cyclopropyl-3-[1-(1,2,4-oxadiazol-3-yl)ethyl]urea (CID 130941339) is 1-cyclopropyl-3-[1-(1,2,4-oxadiazol-3-yl)ethyl]urea.
What is the SMILES notation for 1-cyclopropyl-3-[1-(1,2,4-oxadiazol-3-yl)ethyl]urea?
The canonical SMILES for 1-cyclopropyl-3-[1-(1,2,4-oxadiazol-3-yl)ethyl]urea is CC(NC(=O)NC1CC1)c1ncon1.
What is the InChIKey of 1-cyclopropyl-3-[1-(1,2,4-oxadiazol-3-yl)ethyl]urea?
The InChIKey is RJANBJBXFWPVEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O2/c1-5(7-9-4-14-12-7)10-8(13)11-6-2-3-6/h4-6H,2-3H2,1H3,(H2,10,11,13).
What are the key properties of 1-cyclopropyl-3-[1-(1,2,4-oxadiazol-3-yl)ethyl]urea?
1-cyclopropyl-3-[1-(1,2,4-oxadiazol-3-yl)ethyl]urea has a molecular weight of 196.21 g/mol, XLogP of 0.59, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-3-[1-(1,2,4-oxadiazol-3-yl)ethyl]urea is sourced from PubChem (CID 130941339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).