C8H12N4O2 — CID 130941339
1-cyclopropyl-3-[1-(1,2,4-oxadiazol-3-yl)ethyl]urea (PubChem CID 130941339) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is 1-cyclopropyl-3-[1-(1,2,4-oxadiazol-3-yl)ethyl]urea.
| Compound Name | 1-cyclopropyl-3-[1-(1,2,4-oxadiazol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 130941339 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-cyclopropyl-3-[1-(1,2,4-oxadiazol-3-yl)ethyl]urea |
| SMILES | CC(NC(=O)NC1CC1)c1ncon1 |
| InChI | InChI=1S/C8H12N4O2/c1-5(7-9-4-14-12-7)10-8(13)11-6-2-3-6/h4-6H,2-3H2,1H3,(H2,10,11,13) |
| InChIKey | RJANBJBXFWPVEB-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |