C12H19N3OS — CID 115616432
1-cyclohexyl-3-[1-(1,3-thiazol-2-yl)ethyl]urea (PubChem CID 115616432) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is 1-cyclohexyl-3-[1-(1,3-thiazol-2-yl)ethyl]urea.
| Compound Name | 1-cyclohexyl-3-[1-(1,3-thiazol-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 115616432 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 1-cyclohexyl-3-[1-(1,3-thiazol-2-yl)ethyl]urea |
| SMILES | CC(NC(=O)NC1CCCCC1)c1nccs1 |
| InChI | InChI=1S/C12H19N3OS/c1-9(11-13-7-8-17-11)14-12(16)15-10-5-3-2-4-6-10/h7-10H,2-6H2,1H3,(H2,14,15,16) |
| InChIKey | KJIZKJIXJDCLSY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |