C17H21FN4OS — CID 154748763
1-[1-(3-fluorophenyl)piperidin-3-yl]-3-[1-(1,3-thiazol-2-yl)ethyl]urea (PubChem CID 154748763) has the molecular formula C17H21FN4OS and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-[1-(3-fluorophenyl)piperidin-3-yl]-3-[1-(1,3-thiazol-2-yl)ethyl]urea.
| Compound Name | 1-[1-(3-fluorophenyl)piperidin-3-yl]-3-[1-(1,3-thiazol-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 154748763 |
| Molecular Formula | C17H21FN4OS |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-[1-(3-fluorophenyl)piperidin-3-yl]-3-[1-(1,3-thiazol-2-yl)ethyl]urea |
| SMILES | CC(NC(=O)NC1CCCN(c2cccc(F)c2)C1)c1nccs1 |
| InChI | InChI=1S/C17H21FN4OS/c1-12(16-19-7-9-24-16)20-17(23)21-14-5-3-8-22(11-14)15-6-2-4-13(18)10-15/h2,4,6-7,9-10,12,14H,3,5,8,11H2,1H3,(H2,20,21,23) |
| InChIKey | JILISDRMPPBXQB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |