C16H24FN3O2 — CID 119884178
N-[1-(3-fluorophenyl)piperidin-3-yl]-2-(2-methoxyethylamino)acetamide (PubChem CID 119884178) has the molecular formula C16H24FN3O2 and a molecular weight of 309.39 g/mol. Its IUPAC name is N-[1-(3-fluorophenyl)piperidin-3-yl]-2-(2-methoxyethylamino)acetamide.
| Compound Name | N-[1-(3-fluorophenyl)piperidin-3-yl]-2-(2-methoxyethylamino)acetamide |
|---|---|
| PubChem CID | 119884178 |
| Molecular Formula | C16H24FN3O2 |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | N-[1-(3-fluorophenyl)piperidin-3-yl]-2-(2-methoxyethylamino)acetamide |
| SMILES | COCCNCC(=O)NC1CCCN(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C16H24FN3O2/c1-22-9-7-18-11-16(21)19-14-5-3-8-20(12-14)15-6-2-4-13(17)10-15/h2,4,6,10,14,18H,3,5,7-9,11-12H2,1H3,(H,19,21) |
| InChIKey | HSVICLIZIFKWME-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|