C16H26Cl2FN3O — CID 120565548
4-amino-N-[1-(3-fluorophenyl)piperidin-3-yl]pentanamide;dihydrochloride (PubChem CID 120565548) has the molecular formula C16H26Cl2FN3O and a molecular weight of 366.31 g/mol. Its IUPAC name is 4-amino-N-[1-(3-fluorophenyl)piperidin-3-yl]pentanamide;dihydrochloride.
| Compound Name | 4-amino-N-[1-(3-fluorophenyl)piperidin-3-yl]pentanamide;dihydrochloride |
|---|---|
| PubChem CID | 120565548 |
| Molecular Formula | C16H26Cl2FN3O |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 4-amino-N-[1-(3-fluorophenyl)piperidin-3-yl]pentanamide;dihydrochloride |
| SMILES | CC(N)CCC(=O)NC1CCCN(c2cccc(F)c2)C1.Cl.Cl |
| InChI | InChI=1S/C16H24FN3O.2ClH/c1-12(18)7-8-16(21)19-14-5-3-9-20(11-14)15-6-2-4-13(17)10-15;;/h2,4,6,10,12,14H,3,5,7-9,11,18H2,1H3,(H,19,21);2*1H |
| InChIKey | XSLUPVCCCDMLII-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |