C19H26FN3O — CID 119884134
3-amino-N-[1-(3-fluorophenyl)piperidin-3-yl]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 119884134) has the molecular formula C19H26FN3O and a molecular weight of 331.43 g/mol. Its IUPAC name is 3-amino-N-[1-(3-fluorophenyl)piperidin-3-yl]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | 3-amino-N-[1-(3-fluorophenyl)piperidin-3-yl]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 119884134 |
| Molecular Formula | C19H26FN3O |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 3-amino-N-[1-(3-fluorophenyl)piperidin-3-yl]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | NC1C2CCC(C2)C1C(=O)NC1CCCN(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C19H26FN3O/c20-14-3-1-5-16(10-14)23-8-2-4-15(11-23)22-19(24)17-12-6-7-13(9-12)18(17)21/h1,3,5,10,12-13,15,17-18H,2,4,6-9,11,21H2,(H,22,24) |
| InChIKey | PJACBNMPVRJJPJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |