C15H20FN3OS — CID 119884186
N-[1-(3-fluorophenyl)piperidin-3-yl]-1,3-thiazolidine-4-carboxamide (PubChem CID 119884186) has the molecular formula C15H20FN3OS and a molecular weight of 309.41 g/mol. Its IUPAC name is N-[1-(3-fluorophenyl)piperidin-3-yl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-[1-(3-fluorophenyl)piperidin-3-yl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 119884186 |
| Molecular Formula | C15H20FN3OS |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N-[1-(3-fluorophenyl)piperidin-3-yl]-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(NC1CCCN(c2cccc(F)c2)C1)C1CSCN1 |
| InChI | InChI=1S/C15H20FN3OS/c16-11-3-1-5-13(7-11)19-6-2-4-12(8-19)18-15(20)14-9-21-10-17-14/h1,3,5,7,12,14,17H,2,4,6,8-10H2,(H,18,20) |
| InChIKey | LIRWCFDVHHRCJN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |