C8H13N5O — CID 103912459
1-cyclopropyl-3-[1-(1H-1,2,4-triazol-5-yl)ethyl]urea (PubChem CID 103912459) has the molecular formula C8H13N5O and a molecular weight of 195.23 g/mol. Its IUPAC name is 1-cyclopropyl-3-[1-(1H-1,2,4-triazol-5-yl)ethyl]urea.
| Compound Name | 1-cyclopropyl-3-[1-(1H-1,2,4-triazol-5-yl)ethyl]urea |
|---|---|
| PubChem CID | 103912459 |
| Molecular Formula | C8H13N5O |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 1-cyclopropyl-3-[1-(1H-1,2,4-triazol-5-yl)ethyl]urea |
| SMILES | CC(NC(=O)NC1CC1)c1ncn[nH]1 |
| InChI | InChI=1S/C8H13N5O/c1-5(7-9-4-10-13-7)11-8(14)12-6-2-3-6/h4-6H,2-3H2,1H3,(H,9,10,13)(H2,11,12,14) |
| InChIKey | LVCKVOOKZJWJDR-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |