C12H15N5O3 — CID 60929201
2-(4-methoxyphenoxy)-N-[1-(2H-tetrazol-5-yl)ethyl]acetamide (PubChem CID 60929201) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)-N-[1-(2H-tetrazol-5-yl)ethyl]acetamide.
| Compound Name | 2-(4-methoxyphenoxy)-N-[1-(2H-tetrazol-5-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 60929201 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 2-(4-methoxyphenoxy)-N-[1-(2H-tetrazol-5-yl)ethyl]acetamide |
| SMILES | COc1ccc(OCC(=O)NC(C)c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C12H15N5O3/c1-8(12-14-16-17-15-12)13-11(18)7-20-10-5-3-9(19-2)4-6-10/h3-6,8H,7H2,1-2H3,(H,13,18)(H,14,15,16,17) |
| InChIKey | YFCYRLNAQHPYTJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |