C14H27F3N2O2 — CID 107248523
tert-butyl N-[2-(6,6,6-trifluorohexan-2-ylamino)propyl]carbamate (PubChem CID 107248523) has the molecular formula C14H27F3N2O2 and a molecular weight of 312.38 g/mol. Its IUPAC name is tert-butyl N-[2-(6,6,6-trifluorohexan-2-ylamino)propyl]carbamate.
| Compound Name | tert-butyl N-[2-(6,6,6-trifluorohexan-2-ylamino)propyl]carbamate |
|---|---|
| PubChem CID | 107248523 |
| Molecular Formula | C14H27F3N2O2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | tert-butyl N-[2-(6,6,6-trifluorohexan-2-ylamino)propyl]carbamate |
| SMILES | CC(CCCC(F)(F)F)NC(C)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H27F3N2O2/c1-10(7-6-8-14(15,16)17)19-11(2)9-18-12(20)21-13(3,4)5/h10-11,19H,6-9H2,1-5H3,(H,18,20) |
| InChIKey | OIKZOOMDAFIFPJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |