C9H20N2O3 — CID 60672617
2-[2-(2-hydroxyethoxy)ethylamino]-N,N-dimethylpropanamide (PubChem CID 60672617) has the molecular formula C9H20N2O3 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethylamino]-N,N-dimethylpropanamide.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethylamino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 60672617 |
| Molecular Formula | C9H20N2O3 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethylamino]-N,N-dimethylpropanamide |
| SMILES | CC(NCCOCCO)C(=O)N(C)C |
| InChI | InChI=1S/C9H20N2O3/c1-8(9(13)11(2)3)10-4-6-14-7-5-12/h8,10,12H,4-7H2,1-3H3 |
| InChIKey | OWSLVDMHXDLBTE-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|