C13H29NO2 — CID 28728057
2-[2-(2,6-dimethylheptan-4-ylamino)ethoxy]ethanol (PubChem CID 28728057) has the molecular formula C13H29NO2 and a molecular weight of 231.38 g/mol. Its IUPAC name is 2-[2-(2,6-dimethylheptan-4-ylamino)ethoxy]ethanol.
| Compound Name | 2-[2-(2,6-dimethylheptan-4-ylamino)ethoxy]ethanol |
|---|---|
| PubChem CID | 28728057 |
| Molecular Formula | C13H29NO2 |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.22 |
| IUPAC Name | 2-[2-(2,6-dimethylheptan-4-ylamino)ethoxy]ethanol |
| SMILES | CC(C)CC(CC(C)C)NCCOCCO |
| InChI | InChI=1S/C13H29NO2/c1-11(2)9-13(10-12(3)4)14-5-7-16-8-6-15/h11-15H,5-10H2,1-4H3 |
| InChIKey | WMGDCBWPHOUXRZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|