C10H23NO2 — CID 28728055
2-[2-[[(2S,3S)-3-methylpentan-2-yl]amino]ethoxy]ethanol (PubChem CID 28728055) has the molecular formula C10H23NO2 and a molecular weight of 189.30 g/mol. Its IUPAC name is 2-[2-[[(2S,3S)-3-methylpentan-2-yl]amino]ethoxy]ethanol.
| Compound Name | 2-[2-[[(2S,3S)-3-methylpentan-2-yl]amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 28728055 |
| Molecular Formula | C10H23NO2 |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.17 |
| IUPAC Name | 2-[2-[[(2S,3S)-3-methylpentan-2-yl]amino]ethoxy]ethanol |
| SMILES | CC[C@H](C)[C@H](C)NCCOCCO |
| InChI | InChI=1S/C10H23NO2/c1-4-9(2)10(3)11-5-7-13-8-6-12/h9-12H,4-8H2,1-3H3/t9-,10-/m0/s1 |
| InChIKey | MQWJMFVFWAGYJZ-UWVGGRQHSA-N |
| XLogP | 1.02 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|