C22H45NO — CID 135127559
2,4-dimethyl-N-pentadecan-8-ylpentanamide (PubChem CID 135127559) has the molecular formula C22H45NO and a molecular weight of 339.61 g/mol. Its IUPAC name is 2,4-dimethyl-N-pentadecan-8-ylpentanamide.
| Compound Name | 2,4-dimethyl-N-pentadecan-8-ylpentanamide |
|---|---|
| PubChem CID | 135127559 |
| Molecular Formula | C22H45NO |
| Molecular Weight | 339.61 g/mol |
| Exact Mass | 339.35 |
| IUPAC Name | 2,4-dimethyl-N-pentadecan-8-ylpentanamide |
| SMILES | CCCCCCCC(CCCCCCC)NC(=O)C(C)CC(C)C |
| InChI | InChI=1S/C22H45NO/c1-6-8-10-12-14-16-21(17-15-13-11-9-7-2)23-22(24)20(5)18-19(3)4/h19-21H,6-18H2,1-5H3,(H,23,24) |
| InChIKey | IWTLIJUWAANMAY-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.61 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|