C8H17N3O2 — CID 43579388
2-(3-aminopropanoylamino)-N,N-dimethylpropanamide (PubChem CID 43579388) has the molecular formula C8H17N3O2 and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-(3-aminopropanoylamino)-N,N-dimethylpropanamide.
| Compound Name | 2-(3-aminopropanoylamino)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 43579388 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | 2-(3-aminopropanoylamino)-N,N-dimethylpropanamide |
| SMILES | CC(NC(=O)CCN)C(=O)N(C)C |
| InChI | InChI=1S/C8H17N3O2/c1-6(8(13)11(2)3)10-7(12)4-5-9/h6H,4-5,9H2,1-3H3,(H,10,12) |
| InChIKey | LQRNOWRBZFQMJR-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |