C6H14N2O2 — CID 93083457
3-amino-N-[(2R)-1-hydroxypropan-2-yl]propanamide (PubChem CID 93083457) has the molecular formula C6H14N2O2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 3-amino-N-[(2R)-1-hydroxypropan-2-yl]propanamide.
| Compound Name | 3-amino-N-[(2R)-1-hydroxypropan-2-yl]propanamide |
|---|---|
| PubChem CID | 93083457 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 3-amino-N-[(2R)-1-hydroxypropan-2-yl]propanamide |
| SMILES | C[C@H](CO)NC(=O)CCN |
| InChI | InChI=1S/C6H14N2O2/c1-5(4-9)8-6(10)2-3-7/h5,9H,2-4,7H2,1H3,(H,8,10)/t5-/m1/s1 |
| InChIKey | LKJZHVMTBSWYFF-RXMQYKEDSA-N |
| XLogP | -1.17 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |