C8H15ClN2O2 — CID 43578901
2-(2-chloropropanoylamino)-N,N-dimethylpropanamide (PubChem CID 43578901) has the molecular formula C8H15ClN2O2 and a molecular weight of 206.67 g/mol. Its IUPAC name is 2-(2-chloropropanoylamino)-N,N-dimethylpropanamide.
| Compound Name | 2-(2-chloropropanoylamino)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 43578901 |
| Molecular Formula | C8H15ClN2O2 |
| Molecular Weight | 206.67 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 2-(2-chloropropanoylamino)-N,N-dimethylpropanamide |
| SMILES | CC(Cl)C(=O)NC(C)C(=O)N(C)C |
| InChI | InChI=1S/C8H15ClN2O2/c1-5(9)7(12)10-6(2)8(13)11(3)4/h5-6H,1-4H3,(H,10,12) |
| InChIKey | YNPOSHSEBHMHND-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.67 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|