C10H19N3O4 — CID 20680994
N-[1-(dimethylamino)-1-oxopropan-2-yl]-N'-hydroxy-2-methylbutanediamide (PubChem CID 20680994) has the molecular formula C10H19N3O4 and a molecular weight of 245.28 g/mol. Its IUPAC name is N-[1-(dimethylamino)-1-oxopropan-2-yl]-N'-hydroxy-2-methylbutanediamide.
| Compound Name | N-[1-(dimethylamino)-1-oxopropan-2-yl]-N'-hydroxy-2-methylbutanediamide |
|---|---|
| PubChem CID | 20680994 |
| Molecular Formula | C10H19N3O4 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | N-[1-(dimethylamino)-1-oxopropan-2-yl]-N'-hydroxy-2-methylbutanediamide |
| SMILES | CC(CC(=O)NO)C(=O)NC(C)C(=O)N(C)C |
| InChI | InChI=1S/C10H19N3O4/c1-6(5-8(14)12-17)9(15)11-7(2)10(16)13(3)4/h6-7,17H,5H2,1-4H3,(H,11,15)(H,12,14) |
| InChIKey | KHRZUPPKNWJZDI-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|