C8H14N2O5 — CID 54252173
(2S)-2-[[4-(hydroxyamino)-2-methyl-4-oxobutanoyl]amino]propanoic acid (PubChem CID 54252173) has the molecular formula C8H14N2O5 and a molecular weight of 218.21 g/mol. Its IUPAC name is (2S)-2-[[4-(hydroxyamino)-2-methyl-4-oxobutanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[4-(hydroxyamino)-2-methyl-4-oxobutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 54252173 |
| Molecular Formula | C8H14N2O5 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (2S)-2-[[4-(hydroxyamino)-2-methyl-4-oxobutanoyl]amino]propanoic acid |
| SMILES | CC(CC(=O)NO)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C8H14N2O5/c1-4(3-6(11)10-15)7(12)9-5(2)8(13)14/h4-5,15H,3H2,1-2H3,(H,9,12)(H,10,11)(H,13,14)/t4?,5-/m0/s1 |
| InChIKey | QXNLLCQYMJOXKI-AKGZTFGVSA-N |
| XLogP | -0.89 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|