C14H23NO6 — CID 159636938
(2S)-2-[[(2R)-9-methoxy-2-methyl-4,9-dioxononanoyl]amino]propanoic acid (PubChem CID 159636938) has the molecular formula C14H23NO6 and a molecular weight of 301.34 g/mol. Its IUPAC name is (2S)-2-[[(2R)-9-methoxy-2-methyl-4,9-dioxononanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2R)-9-methoxy-2-methyl-4,9-dioxononanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 159636938 |
| Molecular Formula | C14H23NO6 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | (2S)-2-[[(2R)-9-methoxy-2-methyl-4,9-dioxononanoyl]amino]propanoic acid |
| SMILES | COC(=O)CCCCC(=O)C[C@@H](C)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C14H23NO6/c1-9(13(18)15-10(2)14(19)20)8-11(16)6-4-5-7-12(17)21-3/h9-10H,4-8H2,1-3H3,(H,15,18)(H,19,20)/t9-,10+/m1/s1 |
| InChIKey | NIVNQVMVVGMSHN-ZJUUUORDSA-N |
| XLogP | 0.90 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|