C12H24N2O2S — CID 97027657
(2S)-2-[[(2S)-2-butylsulfanylpropanoyl]amino]-N,N-dimethylpropanamide (PubChem CID 97027657) has the molecular formula C12H24N2O2S and a molecular weight of 260.40 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-butylsulfanylpropanoyl]amino]-N,N-dimethylpropanamide.
| Compound Name | (2S)-2-[[(2S)-2-butylsulfanylpropanoyl]amino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 97027657 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | (2S)-2-[[(2S)-2-butylsulfanylpropanoyl]amino]-N,N-dimethylpropanamide |
| SMILES | CCCCS[C@@H](C)C(=O)N[C@@H](C)C(=O)N(C)C |
| InChI | InChI=1S/C12H24N2O2S/c1-6-7-8-17-10(3)11(15)13-9(2)12(16)14(4)5/h9-10H,6-8H2,1-5H3,(H,13,15)/t9-,10-/m0/s1 |
| InChIKey | HVODVJCYNFXYNU-UWVGGRQHSA-N |
| XLogP | 1.50 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|