(2S)-2-butylsulfanylpropanoyl chloride

C7H13ClOS — CID 135809761

IUPAC(2S)-2-butylsulfanylpropanoyl chloride
SMILESCCCCS[C@@H](C)C(=O)Cl
InChIInChI=1S/C7H13ClOS/c1-3-4-5-10-6(2)7(8)9/h6H,3-5H2,1-2H3/t6-/m0/s1
InChIKeyIRYUVDNRBUKNFN-LURJTMIESA-N
MW180.70 g/mol
LogP2.67
Rot. Bonds5

About (2S)-2-butylsulfanylpropanoyl chloride

(2S)-2-butylsulfanylpropanoyl chloride (PubChem CID 135809761) has the molecular formula C7H13ClOS and a molecular weight of 180.70 g/mol. Its IUPAC name is (2S)-2-butylsulfanylpropanoyl chloride.

Molecular Properties

Compound Name(2S)-2-butylsulfanylpropanoyl chloride
PubChem CID135809761
Molecular FormulaC7H13ClOS
Molecular Weight180.70 g/mol
Exact Mass180.04
IUPAC Name(2S)-2-butylsulfanylpropanoyl chloride
SMILESCCCCS[C@@H](C)C(=O)Cl
InChIInChI=1S/C7H13ClOS/c1-3-4-5-10-6(2)7(8)9/h6H,3-5H2,1-2H3/t6-/m0/s1
InChIKeyIRYUVDNRBUKNFN-LURJTMIESA-N
XLogP2.67
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.70
LogP ≤ 52.67
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze (2S)-2-butylsulfanylpropanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-butylsulfanylpropanoyl chloride?
The IUPAC name of (2S)-2-butylsulfanylpropanoyl chloride (CID 135809761) is (2S)-2-butylsulfanylpropanoyl chloride.
What is the SMILES notation for (2S)-2-butylsulfanylpropanoyl chloride?
The canonical SMILES for (2S)-2-butylsulfanylpropanoyl chloride is CCCCS[C@@H](C)C(=O)Cl.
What is the InChIKey of (2S)-2-butylsulfanylpropanoyl chloride?
The InChIKey is IRYUVDNRBUKNFN-LURJTMIESA-N. The full InChI is InChI=1S/C7H13ClOS/c1-3-4-5-10-6(2)7(8)9/h6H,3-5H2,1-2H3/t6-/m0/s1.
What are the key properties of (2S)-2-butylsulfanylpropanoyl chloride?
(2S)-2-butylsulfanylpropanoyl chloride has a molecular weight of 180.70 g/mol, XLogP of 2.67, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-butylsulfanylpropanoyl chloride is sourced from PubChem (CID 135809761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).