C12H26N2OS — CID 120654893
2-butylsulfanyl-N-[(2R)-2-(ethylamino)propyl]propanamide (PubChem CID 120654893) has the molecular formula C12H26N2OS and a molecular weight of 246.42 g/mol. Its IUPAC name is 2-butylsulfanyl-N-[(2R)-2-(ethylamino)propyl]propanamide.
| Compound Name | 2-butylsulfanyl-N-[(2R)-2-(ethylamino)propyl]propanamide |
|---|---|
| PubChem CID | 120654893 |
| Molecular Formula | C12H26N2OS |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 2-butylsulfanyl-N-[(2R)-2-(ethylamino)propyl]propanamide |
| SMILES | CCCCSC(C)C(=O)NC[C@@H](C)NCC |
| InChI | InChI=1S/C12H26N2OS/c1-5-7-8-16-11(4)12(15)14-9-10(3)13-6-2/h10-11,13H,5-9H2,1-4H3,(H,14,15)/t10-,11?/m1/s1 |
| InChIKey | BVYOYZMQIUSNSN-NFJWQWPMSA-N |
| XLogP | 2.02 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|