About 2-hexylsulfanyldecanoyl chloride
2-hexylsulfanyldecanoyl chloride (PubChem CID 19027841) has the molecular formula C16H31ClOS
and a molecular weight of 306.94 g/mol. Its IUPAC name is 2-hexylsulfanyldecanoyl chloride.
Molecular Properties
| Compound Name | 2-hexylsulfanyldecanoyl chloride |
| PubChem CID | 19027841 |
| Molecular Formula | C16H31ClOS |
| Molecular Weight | 306.94 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2-hexylsulfanyldecanoyl chloride |
| SMILES | CCCCCCCCC(SCCCCCC)C(=O)Cl |
| InChI | InChI=1S/C16H31ClOS/c1-3-5-7-9-10-11-13-15(16(17)18)19-14-12-8-6-4-2/h15H,3-14H2,1-2H3 |
| InChIKey | UFWUNPMCSUJJSK-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.94 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hexylsulfanyldecanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexylsulfanyldecanoyl chloride?
The IUPAC name of 2-hexylsulfanyldecanoyl chloride (CID 19027841) is 2-hexylsulfanyldecanoyl chloride.
What is the SMILES notation for 2-hexylsulfanyldecanoyl chloride?
The canonical SMILES for 2-hexylsulfanyldecanoyl chloride is CCCCCCCCC(SCCCCCC)C(=O)Cl.
What is the InChIKey of 2-hexylsulfanyldecanoyl chloride?
The InChIKey is UFWUNPMCSUJJSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31ClOS/c1-3-5-7-9-10-11-13-15(16(17)18)19-14-12-8-6-4-2/h15H,3-14H2,1-2H3.
What are the key properties of 2-hexylsulfanyldecanoyl chloride?
2-hexylsulfanyldecanoyl chloride has a molecular weight of 306.94 g/mol, XLogP of 6.18, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexylsulfanyldecanoyl chloride is sourced from PubChem (CID 19027841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).