C10H19N3O5 — CID 20681358
N-[1-(dimethylamino)-1-oxopropan-2-yl]-N',3-dihydroxy-2-methylbutanediamide (PubChem CID 20681358) has the molecular formula C10H19N3O5 and a molecular weight of 261.28 g/mol. Its IUPAC name is N-[1-(dimethylamino)-1-oxopropan-2-yl]-N',3-dihydroxy-2-methylbutanediamide.
| Compound Name | N-[1-(dimethylamino)-1-oxopropan-2-yl]-N',3-dihydroxy-2-methylbutanediamide |
|---|---|
| PubChem CID | 20681358 |
| Molecular Formula | C10H19N3O5 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N-[1-(dimethylamino)-1-oxopropan-2-yl]-N',3-dihydroxy-2-methylbutanediamide |
| SMILES | CC(NC(=O)C(C)C(O)C(=O)NO)C(=O)N(C)C |
| InChI | InChI=1S/C10H19N3O5/c1-5(7(14)9(16)12-18)8(15)11-6(2)10(17)13(3)4/h5-7,14,18H,1-4H3,(H,11,15)(H,12,16) |
| InChIKey | IUCJOPSWMKJGII-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|