C12H20N4 — CID 116512868
3-amino-1-methyl-2-(2-methylpropyl)-1-phenylguanidine (PubChem CID 116512868) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is 3-amino-1-methyl-2-(2-methylpropyl)-1-phenylguanidine.
| Compound Name | 3-amino-1-methyl-2-(2-methylpropyl)-1-phenylguanidine |
|---|---|
| PubChem CID | 116512868 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 3-amino-1-methyl-2-(2-methylpropyl)-1-phenylguanidine |
| SMILES | CC(C)C/N=C(\NN)N(C)c1ccccc1 |
| InChI | InChI=1S/C12H20N4/c1-10(2)9-14-12(15-13)16(3)11-7-5-4-6-8-11/h4-8,10H,9,13H2,1-3H3,(H,14,15) |
| InChIKey | QFFOTOZWOSQKFN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|