About 3-amino-1-[1-(dimethylamino)propan-2-yl]-1,2-diethylguanidine
3-amino-1-[1-(dimethylamino)propan-2-yl]-1,2-diethylguanidine (PubChem CID 103192667) has the molecular formula C10H25N5
and a molecular weight of 215.34 g/mol. Its IUPAC name is 3-amino-1-[1-(dimethylamino)propan-2-yl]-1,2-diethylguanidine.
Molecular Properties
| Compound Name | 3-amino-1-[1-(dimethylamino)propan-2-yl]-1,2-diethylguanidine |
| PubChem CID | 103192667 |
| Molecular Formula | C10H25N5 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.21 |
| IUPAC Name | 3-amino-1-[1-(dimethylamino)propan-2-yl]-1,2-diethylguanidine |
| SMILES | CC/N=C(\NN)N(CC)C(C)CN(C)C |
| InChI | InChI=1S/C10H25N5/c1-6-12-10(13-11)15(7-2)9(3)8-14(4)5/h9H,6-8,11H2,1-5H3,(H,12,13) |
| InChIKey | NDUNCCUGHSNSNF-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-1-[1-(dimethylamino)propan-2-yl]-1,2-diethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-[1-(dimethylamino)propan-2-yl]-1,2-diethylguanidine?
The IUPAC name of 3-amino-1-[1-(dimethylamino)propan-2-yl]-1,2-diethylguanidine (CID 103192667) is 3-amino-1-[1-(dimethylamino)propan-2-yl]-1,2-diethylguanidine.
What is the SMILES notation for 3-amino-1-[1-(dimethylamino)propan-2-yl]-1,2-diethylguanidine?
The canonical SMILES for 3-amino-1-[1-(dimethylamino)propan-2-yl]-1,2-diethylguanidine is CC/N=C(\NN)N(CC)C(C)CN(C)C.
What is the InChIKey of 3-amino-1-[1-(dimethylamino)propan-2-yl]-1,2-diethylguanidine?
The InChIKey is NDUNCCUGHSNSNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H25N5/c1-6-12-10(13-11)15(7-2)9(3)8-14(4)5/h9H,6-8,11H2,1-5H3,(H,12,13).
What are the key properties of 3-amino-1-[1-(dimethylamino)propan-2-yl]-1,2-diethylguanidine?
3-amino-1-[1-(dimethylamino)propan-2-yl]-1,2-diethylguanidine has a molecular weight of 215.34 g/mol, XLogP of 0.10, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-[1-(dimethylamino)propan-2-yl]-1,2-diethylguanidine is sourced from PubChem (CID 103192667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).