C20H44N8 — CID 71529808
1-[N'-[3-(dimethylamino)propyl]-N-[N,N'-di(propan-2-yl)carbamimidoyl]carbamimidoyl]-2,3-di(propan-2-yl)guanidine (PubChem CID 71529808) has the molecular formula C20H44N8 and a molecular weight of 396.63 g/mol. Its IUPAC name is 1-[N'-[3-(dimethylamino)propyl]-N-[N,N'-di(propan-2-yl)carbamimidoyl]carbamimidoyl]-2,3-di(propan-2-yl)guanidine.
| Compound Name | 1-[N'-[3-(dimethylamino)propyl]-N-[N,N'-di(propan-2-yl)carbamimidoyl]carbamimidoyl]-2,3-di(propan-2-yl)guanidine |
|---|---|
| PubChem CID | 71529808 |
| Molecular Formula | C20H44N8 |
| Molecular Weight | 396.63 g/mol |
| Exact Mass | 396.37 |
| IUPAC Name | 1-[N'-[3-(dimethylamino)propyl]-N-[N,N'-di(propan-2-yl)carbamimidoyl]carbamimidoyl]-2,3-di(propan-2-yl)guanidine |
| SMILES | CC(C)/N=C(/NC(=NCCCN(C)C)N/C(=N/C(C)C)NC(C)C)NC(C)C |
| InChI | InChI=1S/C20H44N8/c1-14(2)22-19(23-15(3)4)26-18(21-12-11-13-28(9)10)27-20(24-16(5)6)25-17(7)8/h14-17H,11-13H2,1-10H3,(H4,21,22,23,24,25,26,27) |
| InChIKey | ILUKLHBGDLUXGL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 88.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.63 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|