C20H46N8 — CID 176534181
1-[2-[2-[2-[bis(propan-2-ylamino)methylideneamino]ethylamino]ethylamino]ethyl]-2,3-di(propan-2-yl)guanidine (PubChem CID 176534181) has the molecular formula C20H46N8 and a molecular weight of 398.64 g/mol. Its IUPAC name is 1-[2-[2-[2-[bis(propan-2-ylamino)methylideneamino]ethylamino]ethylamino]ethyl]-2,3-di(propan-2-yl)guanidine.
| Compound Name | 1-[2-[2-[2-[bis(propan-2-ylamino)methylideneamino]ethylamino]ethylamino]ethyl]-2,3-di(propan-2-yl)guanidine |
|---|---|
| PubChem CID | 176534181 |
| Molecular Formula | C20H46N8 |
| Molecular Weight | 398.64 g/mol |
| Exact Mass | 398.38 |
| IUPAC Name | 1-[2-[2-[2-[bis(propan-2-ylamino)methylideneamino]ethylamino]ethylamino]ethyl]-2,3-di(propan-2-yl)guanidine |
| SMILES | CC(C)/N=C(\NCCNCCNCCN=C(NC(C)C)NC(C)C)NC(C)C |
| InChI | InChI=1S/C20H46N8/c1-15(2)25-19(26-16(3)4)23-13-11-21-9-10-22-12-14-24-20(27-17(5)6)28-18(7)8/h15-18,21-22H,9-14H2,1-8H3,(H2,23,25,26)(H2,24,27,28) |
| InChIKey | ZRWFIKRYHVNHPB-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 96.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.64 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|