C22H51N9 — CID 176539450
1-[2-[2-[2-[2-[bis(propan-2-ylamino)methylideneamino]ethylamino]ethylamino]ethylamino]ethyl]-2,3-di(propan-2-yl)guanidine (PubChem CID 176539450) has the molecular formula C22H51N9 and a molecular weight of 441.71 g/mol. Its IUPAC name is 1-[2-[2-[2-[2-[bis(propan-2-ylamino)methylideneamino]ethylamino]ethylamino]ethylamino]ethyl]-2,3-di(propan-2-yl)guanidine.
| Compound Name | 1-[2-[2-[2-[2-[bis(propan-2-ylamino)methylideneamino]ethylamino]ethylamino]ethylamino]ethyl]-2,3-di(propan-2-yl)guanidine |
|---|---|
| PubChem CID | 176539450 |
| Molecular Formula | C22H51N9 |
| Molecular Weight | 441.71 g/mol |
| Exact Mass | 441.43 |
| IUPAC Name | 1-[2-[2-[2-[2-[bis(propan-2-ylamino)methylideneamino]ethylamino]ethylamino]ethylamino]ethyl]-2,3-di(propan-2-yl)guanidine |
| SMILES | CC(C)/N=C(\NCCNCCNCCNCCN=C(NC(C)C)NC(C)C)NC(C)C |
| InChI | InChI=1S/C22H51N9/c1-17(2)28-21(29-18(3)4)26-15-13-24-11-9-23-10-12-25-14-16-27-22(30-19(5)6)31-20(7)8/h17-20,23-25H,9-16H2,1-8H3,(H2,26,28,29)(H2,27,30,31) |
| InChIKey | UCUFPBJUFLHDCM-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 108.93 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.71 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|