C12H24N2O2 — CID 11182393
2-N,3-N-bis(3-methoxypropyl)butane-2,3-diimine (PubChem CID 11182393) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-N,3-N-bis(3-methoxypropyl)butane-2,3-diimine.
| Compound Name | 2-N,3-N-bis(3-methoxypropyl)butane-2,3-diimine |
|---|---|
| PubChem CID | 11182393 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 2-N,3-N-bis(3-methoxypropyl)butane-2,3-diimine |
| SMILES | COCCC/N=C(C)/C(C)=N/CCCOC |
| InChI | InChI=1S/C12H24N2O2/c1-11(13-7-5-9-15-3)12(2)14-8-6-10-16-4/h5-10H2,1-4H3/b13-11+,14-12+ |
| InChIKey | CKLPDVKVWOLPKH-PHEQNACWSA-N |
| XLogP | 1.98 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|