C15H17NO3 — CID 7037644
2-[N-(3-methoxypropyl)-C-methylcarbonimidoyl]indene-1,3-dione (PubChem CID 7037644) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is 2-[N-(3-methoxypropyl)-C-methylcarbonimidoyl]indene-1,3-dione.
| Compound Name | 2-[N-(3-methoxypropyl)-C-methylcarbonimidoyl]indene-1,3-dione |
|---|---|
| PubChem CID | 7037644 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-[N-(3-methoxypropyl)-C-methylcarbonimidoyl]indene-1,3-dione |
| SMILES | COCCC/N=C(\C)C1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H17NO3/c1-10(16-8-5-9-19-2)13-14(17)11-6-3-4-7-12(11)15(13)18/h3-4,6-7,13H,5,8-9H2,1-2H3/b16-10+ |
| InChIKey | RYVXZQIOTAIHIF-MHWRWJLKSA-N |
| XLogP | 2.18 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|