C13H18NO3- — CID 145047903
N-(3-methoxypropyl)-3-phenoxypropanimidate (PubChem CID 145047903) has the molecular formula C13H18NO3- and a molecular weight of 236.29 g/mol. Its IUPAC name is N-(3-methoxypropyl)-3-phenoxypropanimidate.
| Compound Name | N-(3-methoxypropyl)-3-phenoxypropanimidate |
|---|---|
| PubChem CID | 145047903 |
| Molecular Formula | C13H18NO3- |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | N-(3-methoxypropyl)-3-phenoxypropanimidate |
| SMILES | COCCC/N=C(\[O-])CCOc1ccccc1 |
| InChI | InChI=1S/C13H19NO3/c1-16-10-5-9-14-13(15)8-11-17-12-6-3-2-4-7-12/h2-4,6-7H,5,8-11H2,1H3,(H,14,15)/p-1 |
| InChIKey | GXXNIHFFQPVHGK-UHFFFAOYSA-M |
| XLogP | 1.25 |
| TPSA | 53.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|