C12H18N2O — CID 63175356
N'-(3-phenoxypropyl)propanimidamide (PubChem CID 63175356) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is N'-(3-phenoxypropyl)propanimidamide.
| Compound Name | N'-(3-phenoxypropyl)propanimidamide |
|---|---|
| PubChem CID | 63175356 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | N'-(3-phenoxypropyl)propanimidamide |
| SMILES | CC/C(N)=N\CCCOc1ccccc1 |
| InChI | InChI=1S/C12H18N2O/c1-2-12(13)14-9-6-10-15-11-7-4-3-5-8-11/h3-5,7-8H,2,6,9-10H2,1H3,(H2,13,14) |
| InChIKey | AEKKLWHKCPKUKS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|