C13H14O4 — CID 69193814
2-(2-methoxyethoxy)-2,3-dihydronaphthalene-1,4-dione (PubChem CID 69193814) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-2,3-dihydronaphthalene-1,4-dione.
| Compound Name | 2-(2-methoxyethoxy)-2,3-dihydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 69193814 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 2-(2-methoxyethoxy)-2,3-dihydronaphthalene-1,4-dione |
| SMILES | COCCOC1CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H14O4/c1-16-6-7-17-12-8-11(14)9-4-2-3-5-10(9)13(12)15/h2-5,12H,6-8H2,1H3 |
| InChIKey | BBGDIRZRHLXTCR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|