C13H16O — CID 63820625
3-(2-methylpropyl)-2,3-dihydroinden-1-one (PubChem CID 63820625) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is 3-(2-methylpropyl)-2,3-dihydroinden-1-one.
| Compound Name | 3-(2-methylpropyl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 63820625 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 3-(2-methylpropyl)-2,3-dihydroinden-1-one |
| SMILES | CC(C)CC1CC(=O)c2ccccc21 |
| InChI | InChI=1S/C13H16O/c1-9(2)7-10-8-13(14)12-6-4-3-5-11(10)12/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | RXKYZCYGUPFXAP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |