C19H15NO — CID 158495411
3-(quinolin-2-ylmethyl)-2,3-dihydroinden-1-one (PubChem CID 158495411) has the molecular formula C19H15NO and a molecular weight of 273.34 g/mol. Its IUPAC name is 3-(quinolin-2-ylmethyl)-2,3-dihydroinden-1-one.
| Compound Name | 3-(quinolin-2-ylmethyl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 158495411 |
| Molecular Formula | C19H15NO |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 3-(quinolin-2-ylmethyl)-2,3-dihydroinden-1-one |
| SMILES | O=C1CC(Cc2ccc3ccccc3n2)c2ccccc21 |
| InChI | InChI=1S/C19H15NO/c21-19-12-14(16-6-2-3-7-17(16)19)11-15-10-9-13-5-1-4-8-18(13)20-15/h1-10,14H,11-12H2 |
| InChIKey | DSHBCNQOBILHES-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |