C24H18N2O2 — CID 102429646
3-(benzo[f]quinolin-3-ylmethyl)-1-phenylpyrrolidine-2,5-dione (PubChem CID 102429646) has the molecular formula C24H18N2O2 and a molecular weight of 366.42 g/mol. Its IUPAC name is 3-(benzo[f]quinolin-3-ylmethyl)-1-phenylpyrrolidine-2,5-dione.
| Compound Name | 3-(benzo[f]quinolin-3-ylmethyl)-1-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 102429646 |
| Molecular Formula | C24H18N2O2 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 3-(benzo[f]quinolin-3-ylmethyl)-1-phenylpyrrolidine-2,5-dione |
| SMILES | O=C1CC(Cc2ccc3c(ccc4ccccc43)n2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C24H18N2O2/c27-23-15-17(24(28)26(23)19-7-2-1-3-8-19)14-18-11-12-21-20-9-5-4-6-16(20)10-13-22(21)25-18/h1-13,17H,14-15H2 |
| InChIKey | FDWBEHATWGPEHJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|