C19H14O — CID 134952620
(3R)-3-naphthalen-1-yl-2,3-dihydroinden-1-one (PubChem CID 134952620) has the molecular formula C19H14O and a molecular weight of 258.32 g/mol. Its IUPAC name is (3R)-3-naphthalen-1-yl-2,3-dihydroinden-1-one.
| Compound Name | (3R)-3-naphthalen-1-yl-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 134952620 |
| Molecular Formula | C19H14O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | (3R)-3-naphthalen-1-yl-2,3-dihydroinden-1-one |
| SMILES | O=C1C[C@H](c2cccc3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C19H14O/c20-19-12-18(16-9-3-4-10-17(16)19)15-11-5-7-13-6-1-2-8-14(13)15/h1-11,18H,12H2/t18-/m1/s1 |
| InChIKey | MDZJBGXFROTGGS-GOSISDBHSA-N |
| XLogP | 4.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |