C17H14O — CID 12669081
tetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10(17),11,13-hexaen-15-one (PubChem CID 12669081) has the molecular formula C17H14O and a molecular weight of 234.30 g/mol. Its IUPAC name is tetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10(17),11,13-hexaen-15-one.
| Compound Name | tetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10(17),11,13-hexaen-15-one |
|---|---|
| PubChem CID | 12669081 |
| Molecular Formula | C17H14O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | tetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10(17),11,13-hexaen-15-one |
| SMILES | O=C1CC2c3ccccc3CCc3cccc1c32 |
| InChI | InChI=1S/C17H14O/c18-16-10-15-13-6-2-1-4-11(13)8-9-12-5-3-7-14(16)17(12)15/h1-7,15H,8-10H2 |
| InChIKey | PSJLMQREUDXANK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |