C18H20OSi — CID 23726934
(3S)-3-phenyl-4-trimethylsilyl-2,3-dihydroinden-1-one (PubChem CID 23726934) has the molecular formula C18H20OSi and a molecular weight of 280.44 g/mol. Its IUPAC name is (3S)-3-phenyl-4-trimethylsilyl-2,3-dihydroinden-1-one.
| Compound Name | (3S)-3-phenyl-4-trimethylsilyl-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 23726934 |
| Molecular Formula | C18H20OSi |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (3S)-3-phenyl-4-trimethylsilyl-2,3-dihydroinden-1-one |
| SMILES | C[Si](C)(C)c1cccc2c1[C@H](c1ccccc1)CC2=O |
| InChI | InChI=1S/C18H20OSi/c1-20(2,3)17-11-7-10-14-16(19)12-15(18(14)17)13-8-5-4-6-9-13/h4-11,15H,12H2,1-3H3/t15-/m0/s1 |
| InChIKey | ILJYXKMBCGTCPT-HNNXBMFYSA-N |
| XLogP | 3.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|